C18H29F3O11 — CID 157306686
methyl (6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane (PubChem CID 157306686) has the molecular formula C18H29F3O11 and a molecular weight of 478.41 g/mol. Its IUPAC name is methyl (6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane.
| Compound Name | methyl (6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane |
|---|---|
| PubChem CID | 157306686 |
| Molecular Formula | C18H29F3O11 |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | methyl (6R,7S)-4-methoxy-4-methyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate;2,2,2-trifluoroacetic acid;1,1,1-trimethoxyethane |
| SMILES | COC(=O)C1CC2O[C@@H]1[C@H]1OC(C)(OC)OC21.COC(C)(OC)OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H16O6.C5H12O3.C2HF3O2/c1-11(14-3)16-8-6-4-5(10(12)13-2)7(15-6)9(8)17-11;1-5(6-2,7-3)8-4;3-2(4,5)1(6)7/h5-9H,4H2,1-3H3;1-4H3;(H,6,7)/t5?,6?,7-,8?,9+,11?;;/m0../s1 |
| InChIKey | SEFKPFLCJKDCKZ-SBGRVVDASA-N |
| XLogP | 1.28 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|