About tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene
tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene (PubChem CID 157306891) has the molecular formula C21H36N3Ta-3
and a molecular weight of 511.49 g/mol. Its IUPAC name is tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene.
Molecular Properties
| Compound Name | tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene |
| PubChem CID | 157306891 |
| Molecular Formula | C21H36N3Ta-3 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene |
| SMILES | CC(C)(C)N=[Ta].CC(C)(C)[N-]C=C[N-]C(C)(C)C.[CH2-]c1ccccc1 |
| InChI | InChI=1S/C10H20N2.C7H7.C4H9N.Ta/c1-9(2,3)11-7-8-12-10(4,5)6;1-7-5-3-2-4-6-7;1-4(2,3)5;/h7-8H,1-6H3;2-6H,1H2;1-3H3;/q-2;-1;; |
| InChIKey | QTNNADHMHMVJHR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 40.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene?
The IUPAC name of tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene (CID 157306891) is tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene.
What is the SMILES notation for tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene?
The canonical SMILES for tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene is CC(C)(C)N=[Ta].CC(C)(C)[N-]C=C[N-]C(C)(C)C.[CH2-]c1ccccc1.
What is the InChIKey of tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene?
The InChIKey is QTNNADHMHMVJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.C7H7.C4H9N.Ta/c1-9(2,3)11-7-8-12-10(4,5)6;1-7-5-3-2-4-6-7;1-4(2,3)5;/h7-8H,1-6H3;2-6H,1H2;1-3H3;/q-2;-1;;.
What are the key properties of tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene?
tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene has a molecular weight of 511.49 g/mol, XLogP of 7.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(2-tert-butylazanidylethenyl)azanide;tert-butyliminotantalum;methanidylbenzene is sourced from PubChem (CID 157306891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).