C26H23F2N3O6S — CID 157307553
ethane;(4-nitrophenyl) 6-[(E)-2-[3-(difluoromethoxy)-2-prop-1-en-2-yloxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate (PubChem CID 157307553) has the molecular formula C26H23F2N3O6S and a molecular weight of 543.55 g/mol. Its IUPAC name is ethane;(4-nitrophenyl) 6-[(E)-2-[3-(difluoromethoxy)-2-prop-1-en-2-yloxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate.
| Compound Name | ethane;(4-nitrophenyl) 6-[(E)-2-[3-(difluoromethoxy)-2-prop-1-en-2-yloxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 157307553 |
| Molecular Formula | C26H23F2N3O6S |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | ethane;(4-nitrophenyl) 6-[(E)-2-[3-(difluoromethoxy)-2-prop-1-en-2-yloxyphenyl]ethenyl]imidazo[2,1-b][1,3]thiazole-5-carboxylate |
| SMILES | C=C(C)Oc1c(/C=C/c2nc3sccn3c2C(=O)Oc2ccc([N+](=O)[O-])cc2)cccc1OC(F)F.CC |
| InChI | InChI=1S/C24H17F2N3O6S.C2H6/c1-14(2)33-21-15(4-3-5-19(21)35-23(25)26)6-11-18-20(28-12-13-36-24(28)27-18)22(30)34-17-9-7-16(8-10-17)29(31)32;1-2/h3-13,23H,1H2,2H3;1-2H3/b11-6+; |
| InChIKey | BCQWEAICVYALBG-ICSBZGNSSA-N |
| XLogP | 7.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|