About trimethoxysilane;hydrochloride
trimethoxysilane;hydrochloride (PubChem CID 157308245) has the molecular formula C3H11ClO3Si
and a molecular weight of 158.66 g/mol. Its IUPAC name is trimethoxysilane;hydrochloride.
Molecular Properties
| Compound Name | trimethoxysilane;hydrochloride |
| PubChem CID | 157308245 |
| Molecular Formula | C3H11ClO3Si |
| Molecular Weight | 158.66 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | trimethoxysilane;hydrochloride |
| SMILES | CO[SiH](OC)OC.Cl |
| InChI | InChI=1S/C3H10O3Si.ClH/c1-4-7(5-2)6-3;/h7H,1-3H3;1H |
| InChIKey | GBGATMPHTZEUHH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.66 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxysilane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxysilane;hydrochloride?
The IUPAC name of trimethoxysilane;hydrochloride (CID 157308245) is trimethoxysilane;hydrochloride.
What is the SMILES notation for trimethoxysilane;hydrochloride?
The canonical SMILES for trimethoxysilane;hydrochloride is CO[SiH](OC)OC.Cl.
What is the InChIKey of trimethoxysilane;hydrochloride?
The InChIKey is GBGATMPHTZEUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.ClH/c1-4-7(5-2)6-3;/h7H,1-3H3;1H.
What are the key properties of trimethoxysilane;hydrochloride?
trimethoxysilane;hydrochloride has a molecular weight of 158.66 g/mol, XLogP of 0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxysilane;hydrochloride is sourced from PubChem (CID 157308245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).