C15H14N2O4 — CID 157308807
3-(3,4-dihydro-2H-furo[2,3-g][1,4]benzoxazin-8-yl)piperidine-2,6-dione (PubChem CID 157308807) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-furo[2,3-g][1,4]benzoxazin-8-yl)piperidine-2,6-dione.
| Compound Name | 3-(3,4-dihydro-2H-furo[2,3-g][1,4]benzoxazin-8-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 157308807 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-(3,4-dihydro-2H-furo[2,3-g][1,4]benzoxazin-8-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(c2coc3cc4c(cc23)OCCN4)C(=O)N1 |
| InChI | InChI=1S/C15H14N2O4/c18-14-2-1-8(15(19)17-14)10-7-21-12-6-11-13(5-9(10)12)20-4-3-16-11/h5-8,16H,1-4H2,(H,17,18,19) |
| InChIKey | UVXSUNSGDPVYHJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|