C32H40Br2N8O6 — CID 157309192
tert-butyl N-[2-[(3-amino-6-bromoquinolin-4-yl)amino]ethyl]carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate (PubChem CID 157309192) has the molecular formula C32H40Br2N8O6 and a molecular weight of 792.53 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-amino-6-bromoquinolin-4-yl)amino]ethyl]carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-amino-6-bromoquinolin-4-yl)amino]ethyl]carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 157309192 |
| Molecular Formula | C32H40Br2N8O6 |
| Molecular Weight | 792.53 g/mol |
| Exact Mass | 790.14 |
| IUPAC Name | tert-butyl N-[2-[(3-amino-6-bromoquinolin-4-yl)amino]ethyl]carbamate;tert-butyl N-[2-[(6-bromo-3-nitroquinolin-4-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1c(N)cnc2ccc(Br)cc12.CC(C)(C)OC(=O)NCCNc1c([N+](=O)[O-])cnc2ccc(Br)cc12 |
| InChI | InChI=1S/C16H19BrN4O4.C16H21BrN4O2/c1-16(2,3)25-15(22)19-7-6-18-14-11-8-10(17)4-5-12(11)20-9-13(14)21(23)24;1-16(2,3)23-15(22)20-7-6-19-14-11-8-10(17)4-5-13(11)21-9-12(14)18/h4-5,8-9H,6-7H2,1-3H3,(H,18,20)(H,19,22);4-5,8-9H,6-7,18H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | BCVMIMCAPYMXBF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 195.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|