C32H46BBrF2N2O4 — CID 157309197
1-[2-(4-bromo-2-fluorophenoxy)ethyl]piperidine;1-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperidine (PubChem CID 157309197) has the molecular formula C32H46BBrF2N2O4 and a molecular weight of 651.44 g/mol. Its IUPAC name is 1-[2-(4-bromo-2-fluorophenoxy)ethyl]piperidine;1-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperidine.
| Compound Name | 1-[2-(4-bromo-2-fluorophenoxy)ethyl]piperidine;1-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 157309197 |
| Molecular Formula | C32H46BBrF2N2O4 |
| Molecular Weight | 651.44 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | 1-[2-(4-bromo-2-fluorophenoxy)ethyl]piperidine;1-[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]piperidine |
| SMILES | CC1(C)OB(c2ccc(OCCN3CCCCC3)c(F)c2)OC1(C)C.Fc1cc(Br)ccc1OCCN1CCCCC1 |
| InChI | InChI=1S/C19H29BFNO3.C13H17BrFNO/c1-18(2)19(3,4)25-20(24-18)15-8-9-17(16(21)14-15)23-13-12-22-10-6-5-7-11-22;14-11-4-5-13(12(15)10-11)17-9-8-16-6-2-1-3-7-16/h8-9,14H,5-7,10-13H2,1-4H3;4-5,10H,1-3,6-9H2 |
| InChIKey | BCVMQPKIDRPGOU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.44 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|