About CID 157312110
CID 157312110 (PubChem CID 157312110) has the molecular formula C37H3Br12Cl11O12P2-2
and a molecular weight of 2050.20 g/mol.
Molecular Properties
| Compound Name | CID 157312110 |
| PubChem CID | 157312110 |
| Molecular Formula | C37H3Br12Cl11O12P2-2 |
| Molecular Weight | 2050.20 g/mol |
| Exact Mass | 2032.59 |
| IUPAC Name | — |
| SMILES | Brc1c(Br)c(Br)c2c(c1Br)O[P-]13(O2)(Oc2c(Br)c(Br)c(Br)c(Br)c2O1)Oc1c(Br)c(Br)c(Br)c(Br)c1O3.Cc1c(Cl)c(Cl)c2c(c1Cl)O[P-]13(O2)(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2O1)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O3 |
| InChI | InChI=1S/C19H3Cl11O6P.C18Br12O6P/c1-2-3(20)9(26)15-14(4(2)21)31-37(32-15,33-16-10(27)5(22)6(23)11(28)17(16)34-37)35-18-12(29)7(24)8(25)13(30)19(18)36-37;19-1-2(20)8(26)14-13(7(1)25)31-37(32-14,33-15-9(27)3(21)4(22)10(28)16(15)34-37)35-17-11(29)5(23)6(24)12(30)18(17)36-37/h1H3;/q2*-1 |
| InChIKey | BDDQMQAKTXDTQJ-UHFFFAOYSA-N |
| XLogP | 26.61 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 2050.20 |
| LogP ≤ 5 | 26.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 157312110 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157312110?
The IUPAC name of CID 157312110 (CID 157312110) is not available.
What is the SMILES notation for CID 157312110?
The canonical SMILES for CID 157312110 is Brc1c(Br)c(Br)c2c(c1Br)O[P-]13(O2)(Oc2c(Br)c(Br)c(Br)c(Br)c2O1)Oc1c(Br)c(Br)c(Br)c(Br)c1O3.Cc1c(Cl)c(Cl)c2c(c1Cl)O[P-]13(O2)(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2O1)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O3.
What is the InChIKey of CID 157312110?
The InChIKey is BDDQMQAKTXDTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H3Cl11O6P.C18Br12O6P/c1-2-3(20)9(26)15-14(4(2)21)31-37(32-15,33-16-10(27)5(22)6(23)11(28)17(16)34-37)35-18-12(29)7(24)8(25)13(30)19(18)36-37;19-1-2(20)8(26)14-13(7(1)25)31-37(32-14,33-15-9(27)3(21)4(22)10(28)16(15)34-37)35-17-11(29)5(23)6(24)12(30)18(17)36-37/h1H3;/q2*-1.
What are the key properties of CID 157312110?
CID 157312110 has a molecular weight of 2050.20 g/mol, XLogP of 26.61, 0 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157312110 is sourced from PubChem (CID 157312110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).