C14H24O3 — CID 157312533
2-propoxyethyl (3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate (PubChem CID 157312533) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 2-propoxyethyl (3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate.
| Compound Name | 2-propoxyethyl (3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 157312533 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-propoxyethyl (3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
| SMILES | CCCOCCOC(=O)C1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C14H24O3/c1-2-6-16-7-8-17-14(15)13-9-11-4-3-5-12(11)10-13/h11-13H,2-10H2,1H3/t11-,12+,13? |
| InChIKey | DAPUGZXSZODYRP-FUNVUKJBSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|