C55H48O6S2Si3 — CID 157312647
methane;4-(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)benzenesulfonate;triphenylsulfanium (PubChem CID 157312647) has the molecular formula C55H48O6S2Si3 and a molecular weight of 953.38 g/mol. Its IUPAC name is methane;4-(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)benzenesulfonate;triphenylsulfanium.
| Compound Name | methane;4-(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)benzenesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 157312647 |
| Molecular Formula | C55H48O6S2Si3 |
| Molecular Weight | 953.38 g/mol |
| Exact Mass | 952.22 |
| IUPAC Name | methane;4-(2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)benzenesulfonate;triphenylsulfanium |
| SMILES | C.O=S(=O)([O-])c1ccc([Si]2(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30O6SSi3.C18H15S.CH4/c37-43(38,39)30-26-28-36(29-27-30)46(35-24-14-5-15-25-35)41-44(31-16-6-1-7-17-31,32-18-8-2-9-19-32)40-45(42-46,33-20-10-3-11-21-33)34-22-12-4-13-23-34;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-29H,(H,37,38,39);1-15H;1H4/q;+1;/p-1 |
| InChIKey | BDFJEXRJDVIDLP-UHFFFAOYSA-M |
| XLogP | 8.14 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.38 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|