C83H71B18F4O27S3-3 — CID 157312816
CID 157312816 (PubChem CID 157312816) has the molecular formula C83H71B18F4O27S3-3 and a molecular weight of 1867.26 g/mol.
| Compound Name | CID 157312816 |
|---|---|
| PubChem CID | 157312816 |
| Molecular Formula | C83H71B18F4O27S3-3 |
| Molecular Weight | 1867.26 g/mol |
| Exact Mass | 1869.50 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(OC(=O)C(C)(C(=O)OCCS(=O)(=O)[O-])C(=O)Oc2c(C[B])cc(C[B])cc2C[B])c(C[B])c1.[B]Cc1cc(C[B])c(OC(=O)C2CC(C(=O)OCC(F)(F)S(=O)(=O)[O-])CC(C(=O)Oc3c(C[B])cc(C[B])cc3C[B])C2)c(C[B])c1.[B]Cc1cc(C[B])c(OC(=O)c2cc(C(=O)OCC(F)(F)S(=O)(=O)[O-])cc(C(=O)Oc3c(C[B])cc(C[B])cc3C[B])c2)c(C[B])c1 |
| InChI | InChI=1S/C29H28B6F2O9S.C29H22B6F2O9S.C25H24B6O9S/c2*30-8-15-1-20(10-32)24(21(2-15)11-33)45-27(39)18-5-17(26(38)44-14-29(36,37)47(41,42)43)6-19(7-18)28(40)46-25-22(12-34)3-16(9-31)4-23(25)13-35;1-25(22(32)38-2-3-41(35,36)37,23(33)39-20-16(10-28)4-14(8-26)5-17(20)11-29)24(34)40-21-18(12-30)6-15(9-27)7-19(21)13-31/h1-4,17-19H,5-14H2,(H,41,42,43);1-7H,8-14H2,(H,41,42,43);4-7H,2-3,8-13H2,1H3,(H,35,36,37)/p-3 |
| InChIKey | WVNATIXPCNGGTD-UHFFFAOYSA-K |
| XLogP | 1.66 |
| TPSA | 408.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 135 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1867.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|