C21H18F3NO2S — CID 157313367
2-[(4aS,5S,7aS)-5-(difluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 157313367) has the molecular formula C21H18F3NO2S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-[(4aS,5S,7aS)-5-(difluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,5S,7aS)-5-(difluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 157313367 |
| Molecular Formula | C21H18F3NO2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-[(4aS,5S,7aS)-5-(difluoromethyl)-7a-(2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | O=C(CC1=N[C@@]2(c3ccccc3F)CO[C@H](C(F)F)[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H18F3NO2S/c22-16-9-5-4-8-14(16)21-12-27-19(20(23)24)15(21)11-28-18(25-21)10-17(26)13-6-2-1-3-7-13/h1-9,15,19-20H,10-12H2/t15-,19+,21-/m1/s1 |
| InChIKey | OEQKWDNHCCZPPP-MFMILTCTSA-N |
| XLogP | 4.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |