C31H36O8 — CID 157314444
benzene-1,3-diol;4-[3,4-bis(2,4-dihydroxyphenyl)butyl]benzene-1,3-diol;propane (PubChem CID 157314444) has the molecular formula C31H36O8 and a molecular weight of 536.62 g/mol. Its IUPAC name is benzene-1,3-diol;4-[3,4-bis(2,4-dihydroxyphenyl)butyl]benzene-1,3-diol;propane.
| Compound Name | benzene-1,3-diol;4-[3,4-bis(2,4-dihydroxyphenyl)butyl]benzene-1,3-diol;propane |
|---|---|
| PubChem CID | 157314444 |
| Molecular Formula | C31H36O8 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | benzene-1,3-diol;4-[3,4-bis(2,4-dihydroxyphenyl)butyl]benzene-1,3-diol;propane |
| SMILES | CCC.Oc1ccc(CCC(Cc2ccc(O)cc2O)c2ccc(O)cc2O)c(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C22H22O6.C6H6O2.C3H8/c23-16-5-3-13(20(26)10-16)1-2-14(19-8-7-18(25)12-22(19)28)9-15-4-6-17(24)11-21(15)27;7-5-2-1-3-6(8)4-5;1-3-2/h3-8,10-12,14,23-28H,1-2,9H2;1-4,7-8H;3H2,1-2H3 |
| InChIKey | BDKRHMHDYQZHIH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |