C15H8Cl2FN3O3 — CID 157314631
methyl 3-[5-(5,6-dichloro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoate (PubChem CID 157314631) has the molecular formula C15H8Cl2FN3O3 and a molecular weight of 368.15 g/mol. Its IUPAC name is methyl 3-[5-(5,6-dichloro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoate.
| Compound Name | methyl 3-[5-(5,6-dichloro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 157314631 |
| Molecular Formula | C15H8Cl2FN3O3 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | methyl 3-[5-(5,6-dichloro-3-pyridinyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoate |
| SMILES | COC(=O)c1cccc(-c2noc(-c3cnc(Cl)c(Cl)c3)n2)c1F |
| InChI | InChI=1S/C15H8Cl2FN3O3/c1-23-15(22)9-4-2-3-8(11(9)18)13-20-14(24-21-13)7-5-10(16)12(17)19-6-7/h2-6H,1H3 |
| InChIKey | BDLHGSUZUUVRII-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|