C68H67B12O23S3-3 — CID 157315323
CID 157315323 (PubChem CID 157315323) has the molecular formula C68H67B12O23S3-3 and a molecular weight of 1478.21 g/mol.
| Compound Name | CID 157315323 |
|---|---|
| PubChem CID | 157315323 |
| Molecular Formula | C68H67B12O23S3-3 |
| Molecular Weight | 1478.21 g/mol |
| Exact Mass | 1479.44 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(C[B])c(C(=O)OC2CC3CC(C(=O)OCCS(=O)(=O)[O-])C2C3)c1.[B]Cc1cc(C[B])c(C[B])c(C(=O)OC2CCCC(C(=O)OCCS(=O)(=O)[O-])C2)c1.[B]Cc1cc(C[B])c(C[B])c(C(=O)Oc2cc(OC(=O)c3cc(C[B])cc(C[B])c3C[B])cc(C(=O)OCCS(=O)(=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H24B6O9S.C20H23B3O7S.C19H23B3O7S/c30-10-16-3-19(12-32)25(14-34)23(5-16)28(37)43-21-7-18(27(36)42-1-2-45(39,40)41)8-22(9-21)44-29(38)24-6-17(11-31)4-20(13-33)26(24)15-35;21-8-12-3-13(9-22)17(10-23)16(6-12)20(25)30-18-7-11-4-14(18)15(5-11)19(24)29-1-2-31(26,27)28;20-9-12-6-14(10-21)17(11-22)16(7-12)19(24)29-15-3-1-2-13(8-15)18(23)28-4-5-30(25,26)27/h3-9H,1-2,10-15H2,(H,39,40,41);3,6,11,14-15,18H,1-2,4-5,7-10H2,(H,26,27,28);6-7,13,15H,1-5,8-11H2,(H,25,26,27)/p-3 |
| InChIKey | LEFVQZVOAMILPN-UHFFFAOYSA-K |
| XLogP | 1.69 |
| TPSA | 355.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 106 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1478.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|