C20H15F2N5O3 — CID 157316497
2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone (PubChem CID 157316497) has the molecular formula C20H15F2N5O3 and a molecular weight of 411.37 g/mol. Its IUPAC name is 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone.
| Compound Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone |
|---|---|
| PubChem CID | 157316497 |
| Molecular Formula | C20H15F2N5O3 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone |
| SMILES | Cc1ncc2c(n1)CN(C(=O)Cc1nc(-c3ccc(F)cc3F)ccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C20H15F2N5O3/c1-11-23-8-12-9-26(10-18(12)24-11)20(28)7-17-19(27(29)30)5-4-16(25-17)14-3-2-13(21)6-15(14)22/h2-6,8H,7,9-10H2,1H3 |
| InChIKey | YURJIUMGUZMFHP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|