C27H27FN6O — CID 157316849
1-[3-[3-fluoro-6-[3-(4-methylpiperidin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 157316849) has the molecular formula C27H27FN6O and a molecular weight of 470.55 g/mol. Its IUPAC name is 1-[3-[3-fluoro-6-[3-(4-methylpiperidin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[3-fluoro-6-[3-(4-methylpiperidin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157316849 |
| Molecular Formula | C27H27FN6O |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[3-[3-fluoro-6-[3-(4-methylpiperidin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3cccc(N4CCC(C)CC4)c3)nc3n[nH]c(F)c23)c1 |
| InChI | InChI=1S/C27H27FN6O/c1-3-22(35)15-18-6-4-7-19(14-18)24-23-25(28)32-33-26(23)31-27(30-24)29-20-8-5-9-21(16-20)34-12-10-17(2)11-13-34/h3-9,14,16-17H,1,10-13,15H2,2H3,(H2,29,30,31,32,33) |
| InChIKey | JRFIOWUAVPBLKZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|