C21H25NO3S — CID 157316860
1-[1-(2,4-dimethylphenyl)sulfonylpiperidin-4-yl]-2-phenylethanone (PubChem CID 157316860) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylphenyl)sulfonylpiperidin-4-yl]-2-phenylethanone.
| Compound Name | 1-[1-(2,4-dimethylphenyl)sulfonylpiperidin-4-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 157316860 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[1-(2,4-dimethylphenyl)sulfonylpiperidin-4-yl]-2-phenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H25NO3S/c1-16-8-9-21(17(2)14-16)26(24,25)22-12-10-19(11-13-22)20(23)15-18-6-4-3-5-7-18/h3-9,14,19H,10-13,15H2,1-2H3 |
| InChIKey | BDRSFCLBRMLMIM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |