C30H33ClFN3 — CID 157317221
4-[2-(5-chloropent-1-ynyl)-5-(4-fluorocyclohexa-1,3-dien-1-yl)-3-(3-phenylpropyl)imidazol-4-yl]pyridine;ethane (PubChem CID 157317221) has the molecular formula C30H33ClFN3 and a molecular weight of 490.07 g/mol. Its IUPAC name is 4-[2-(5-chloropent-1-ynyl)-5-(4-fluorocyclohexa-1,3-dien-1-yl)-3-(3-phenylpropyl)imidazol-4-yl]pyridine;ethane.
| Compound Name | 4-[2-(5-chloropent-1-ynyl)-5-(4-fluorocyclohexa-1,3-dien-1-yl)-3-(3-phenylpropyl)imidazol-4-yl]pyridine;ethane |
|---|---|
| PubChem CID | 157317221 |
| Molecular Formula | C30H33ClFN3 |
| Molecular Weight | 490.07 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 4-[2-(5-chloropent-1-ynyl)-5-(4-fluorocyclohexa-1,3-dien-1-yl)-3-(3-phenylpropyl)imidazol-4-yl]pyridine;ethane |
| SMILES | CC.FC1=CC=C(c2nc(C#CCCCCl)n(CCCc3ccccc3)c2-c2ccncc2)CC1 |
| InChI | InChI=1S/C28H27ClFN3.C2H6/c29-18-6-2-5-11-26-32-27(23-12-14-25(30)15-13-23)28(24-16-19-31-20-17-24)33(26)21-7-10-22-8-3-1-4-9-22;1-2/h1,3-4,8-9,12,14,16-17,19-20H,2,6-7,10,13,15,18,21H2;1-2H3 |
| InChIKey | BDSZPRNLOYNNCB-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.07 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|