C51H51FN2O6 — CID 157317253
methyl 2-[4-[4-[6-fluoro-1-(oxan-2-yl)-2-[(3S,5S)-5-(trityloxymethyl)oxolan-3-yl]oxypyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]acetate (PubChem CID 157317253) has the molecular formula C51H51FN2O6 and a molecular weight of 806.98 g/mol. Its IUPAC name is methyl 2-[4-[4-[6-fluoro-1-(oxan-2-yl)-2-[(3S,5S)-5-(trityloxymethyl)oxolan-3-yl]oxypyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]acetate.
| Compound Name | methyl 2-[4-[4-[6-fluoro-1-(oxan-2-yl)-2-[(3S,5S)-5-(trityloxymethyl)oxolan-3-yl]oxypyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 157317253 |
| Molecular Formula | C51H51FN2O6 |
| Molecular Weight | 806.98 g/mol |
| Exact Mass | 806.37 |
| IUPAC Name | methyl 2-[4-[4-[6-fluoro-1-(oxan-2-yl)-2-[(3S,5S)-5-(trityloxymethyl)oxolan-3-yl]oxypyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclohex-3-en-1-yl]acetate |
| SMILES | COC(=O)CC1CC=C(c2ccc(-c3nc4cc(O[C@@H]5CO[C@H](COC(c6ccccc6)(c6ccccc6)c6ccccc6)C5)n(C5CCCCO5)c4cc3F)cc2)CC1 |
| InChI | InChI=1S/C51H51FN2O6/c1-56-49(55)29-35-20-22-36(23-21-35)37-24-26-38(27-25-37)50-44(52)31-46-45(53-50)32-48(54(46)47-19-11-12-28-57-47)60-43-30-42(58-33-43)34-59-51(39-13-5-2-6-14-39,40-15-7-3-8-16-40)41-17-9-4-10-18-41/h2-10,13-18,22,24-27,31-32,35,42-43,47H,11-12,19-21,23,28-30,33-34H2,1H3/t35?,42-,43-,47?/m0/s1 |
| InChIKey | OLGGSIARNBUKGV-UCCJDOPXSA-N |
| XLogP | 10.83 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.98 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|