C13H17NO10S — CID 157318737
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;[4-(methylamino)phenyl] hydrogen sulfate (PubChem CID 157318737) has the molecular formula C13H17NO10S and a molecular weight of 379.34 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;[4-(methylamino)phenyl] hydrogen sulfate.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;[4-(methylamino)phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 157318737 |
| Molecular Formula | C13H17NO10S |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;[4-(methylamino)phenyl] hydrogen sulfate |
| SMILES | CNc1ccc(OS(=O)(=O)O)cc1.O=C1O[C@H]([C@@H](O)CO)C(O)=C1O |
| InChI | InChI=1S/C7H9NO4S.C6H8O6/c1-8-6-2-4-7(5-3-6)12-13(9,10)11;7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,8H,1H3,(H,9,10,11);2,5,7-10H,1H2/t;2-,5+/m.0/s1 |
| InChIKey | BDXJBNOXEJZHAN-MGMRMFRLSA-N |
| XLogP | -0.50 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|