C33H68O8 — CID 157319406
2-[2-butoxy-3-(2,3-dibutoxypropoxy)propoxy]-1-(2,3-dibutoxypropoxy)butane (PubChem CID 157319406) has the molecular formula C33H68O8 and a molecular weight of 592.90 g/mol. Its IUPAC name is 2-[2-butoxy-3-(2,3-dibutoxypropoxy)propoxy]-1-(2,3-dibutoxypropoxy)butane.
| Compound Name | 2-[2-butoxy-3-(2,3-dibutoxypropoxy)propoxy]-1-(2,3-dibutoxypropoxy)butane |
|---|---|
| PubChem CID | 157319406 |
| Molecular Formula | C33H68O8 |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.49 |
| IUPAC Name | 2-[2-butoxy-3-(2,3-dibutoxypropoxy)propoxy]-1-(2,3-dibutoxypropoxy)butane |
| SMILES | CCCCOCC(COCC(CC)OCC(COCC(COCCCC)OCCCC)OCCCC)OCCCC |
| InChI | InChI=1S/C33H68O8/c1-7-13-18-34-24-31(38-20-15-9-3)26-36-23-30(12-6)41-29-33(40-22-17-11-5)28-37-27-32(39-21-16-10-4)25-35-19-14-8-2/h30-33H,7-29H2,1-6H3 |
| InChIKey | HQIAELOJKGZNGS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|