About 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine
2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine (PubChem CID 157322208) has the molecular formula C32H43ClN2
and a molecular weight of 491.16 g/mol. Its IUPAC name is 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine |
| PubChem CID | 157322208 |
| Molecular Formula | C32H43ClN2 |
| Molecular Weight | 491.16 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(Cl)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H43ClN2/c1-29(2,3)22-13-20(14-23(17-22)30(4,5)6)26-19-27(35-28(33)34-26)21-15-24(31(7,8)9)18-25(16-21)32(10,11)12/h13-19H,1-12H3 |
| InChIKey | KNVNNIGJVWPFIN-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.16 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine?
The IUPAC name of 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine (CID 157322208) is 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine.
What is the SMILES notation for 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine?
The canonical SMILES for 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine is CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(Cl)n2)cc(C(C)(C)C)c1.
What is the InChIKey of 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine?
The InChIKey is KNVNNIGJVWPFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H43ClN2/c1-29(2,3)22-13-20(14-23(17-22)30(4,5)6)26-19-27(35-28(33)34-26)21-15-24(31(7,8)9)18-25(16-21)32(10,11)12/h13-19H,1-12H3.
What are the key properties of 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine?
2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine has a molecular weight of 491.16 g/mol, XLogP of 9.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-bis(3,5-ditert-butylphenyl)pyrimidine is sourced from PubChem (CID 157322208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).