About butane;O-propyl methylsulfanylmethanethioate
butane;O-propyl methylsulfanylmethanethioate (PubChem CID 157322444) has the molecular formula C9H20OS2
and a molecular weight of 208.39 g/mol. Its IUPAC name is butane;O-propyl methylsulfanylmethanethioate.
Molecular Properties
| Compound Name | butane;O-propyl methylsulfanylmethanethioate |
| PubChem CID | 157322444 |
| Molecular Formula | C9H20OS2 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | butane;O-propyl methylsulfanylmethanethioate |
| SMILES | CCCC.CCCOC(=S)SC |
| InChI | InChI=1S/C5H10OS2.C4H10/c1-3-4-6-5(7)8-2;1-3-4-2/h3-4H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | BEICCSPNJDGMRX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butane;O-propyl methylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;O-propyl methylsulfanylmethanethioate?
The IUPAC name of butane;O-propyl methylsulfanylmethanethioate (CID 157322444) is butane;O-propyl methylsulfanylmethanethioate.
What is the SMILES notation for butane;O-propyl methylsulfanylmethanethioate?
The canonical SMILES for butane;O-propyl methylsulfanylmethanethioate is CCCC.CCCOC(=S)SC.
What is the InChIKey of butane;O-propyl methylsulfanylmethanethioate?
The InChIKey is BEICCSPNJDGMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS2.C4H10/c1-3-4-6-5(7)8-2;1-3-4-2/h3-4H2,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;O-propyl methylsulfanylmethanethioate?
butane;O-propyl methylsulfanylmethanethioate has a molecular weight of 208.39 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;O-propyl methylsulfanylmethanethioate is sourced from PubChem (CID 157322444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).