C48H64NO12- — CID 157323178
carbanide;3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene (PubChem CID 157323178) has the molecular formula C48H64NO12- and a molecular weight of 847.03 g/mol. Its IUPAC name is carbanide;3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene.
| Compound Name | carbanide;3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
|---|---|
| PubChem CID | 157323178 |
| Molecular Formula | C48H64NO12- |
| Molecular Weight | 847.03 g/mol |
| Exact Mass | 846.44 |
| IUPAC Name | carbanide;3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
| SMILES | Cc1cc(C)cc(C(=O)OCCCNCCOC(=O)c2cc(C)cc(C)c2)c1.[CH3-].c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C24H32O8.C23H29NO4.CH3/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;1-16-10-17(2)13-20(12-16)22(25)27-8-5-6-24-7-9-28-23(26)21-14-18(3)11-19(4)15-21;/h1-8H,9-20H2;10-15,24H,5-9H2,1-4H3;1H3/q;;-1 |
| InChIKey | BEKHMQGBFKHLLN-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.03 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|