C19H24N2O8 — CID 157323344
dimethyl 2-(2-oxocyclopentyl)propanedioate;4-hydroxy-5-(2-oxocyclopentyl)-1H-pyrimidin-6-one (PubChem CID 157323344) has the molecular formula C19H24N2O8 and a molecular weight of 408.41 g/mol. Its IUPAC name is dimethyl 2-(2-oxocyclopentyl)propanedioate;4-hydroxy-5-(2-oxocyclopentyl)-1H-pyrimidin-6-one.
| Compound Name | dimethyl 2-(2-oxocyclopentyl)propanedioate;4-hydroxy-5-(2-oxocyclopentyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 157323344 |
| Molecular Formula | C19H24N2O8 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | dimethyl 2-(2-oxocyclopentyl)propanedioate;4-hydroxy-5-(2-oxocyclopentyl)-1H-pyrimidin-6-one |
| SMILES | COC(=O)C(C(=O)OC)C1CCCC1=O.O=C1CCCC1c1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C10H14O5.C9H10N2O3/c1-14-9(12)8(10(13)15-2)6-4-3-5-7(6)11;12-6-3-1-2-5(6)7-8(13)10-4-11-9(7)14/h6,8H,3-5H2,1-2H3;4-5H,1-3H2,(H2,10,11,13,14) |
| InChIKey | BEKUSIBWEJJATM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|