C28H23Cl2F2N3O4S2 — CID 157323564
[(2R,4S)-1-[[2,5-difluoro-4-(1,2,4-thiadiazol-5-ylmethylsulfonyl)phenyl]methyl]-2-phenylpiperidin-4-yl] 3,5-dichlorobenzoate (PubChem CID 157323564) has the molecular formula C28H23Cl2F2N3O4S2 and a molecular weight of 638.55 g/mol. Its IUPAC name is [(2R,4S)-1-[[2,5-difluoro-4-(1,2,4-thiadiazol-5-ylmethylsulfonyl)phenyl]methyl]-2-phenylpiperidin-4-yl] 3,5-dichlorobenzoate.
| Compound Name | [(2R,4S)-1-[[2,5-difluoro-4-(1,2,4-thiadiazol-5-ylmethylsulfonyl)phenyl]methyl]-2-phenylpiperidin-4-yl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 157323564 |
| Molecular Formula | C28H23Cl2F2N3O4S2 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 637.05 |
| IUPAC Name | [(2R,4S)-1-[[2,5-difluoro-4-(1,2,4-thiadiazol-5-ylmethylsulfonyl)phenyl]methyl]-2-phenylpiperidin-4-yl] 3,5-dichlorobenzoate |
| SMILES | O=C(O[C@H]1CCN(Cc2cc(F)c(S(=O)(=O)Cc3ncns3)cc2F)[C@@H](c2ccccc2)C1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C28H23Cl2F2N3O4S2/c29-20-8-18(9-21(30)11-20)28(36)39-22-6-7-35(25(12-22)17-4-2-1-3-5-17)14-19-10-24(32)26(13-23(19)31)41(37,38)15-27-33-16-34-40-27/h1-5,8-11,13,16,22,25H,6-7,12,14-15H2/t22-,25+/m0/s1 |
| InChIKey | BELMFYDGZFMJFW-WIOPSUGQSA-N |
| XLogP | 6.66 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |