About heptan-1-amine;4-methylcyclohexan-1-amine
heptan-1-amine;4-methylcyclohexan-1-amine (PubChem CID 157323652) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is heptan-1-amine;4-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | heptan-1-amine;4-methylcyclohexan-1-amine |
| PubChem CID | 157323652 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | heptan-1-amine;4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(N)CC1.CCCCCCCN |
| InChI | InChI=1S/C7H15N.C7H17N/c1-6-2-4-7(8)5-3-6;1-2-3-4-5-6-7-8/h6-7H,2-5,8H2,1H3;2-8H2,1H3 |
| InChIKey | BELQSCHPUNSCOM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-1-amine;4-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-1-amine;4-methylcyclohexan-1-amine?
The IUPAC name of heptan-1-amine;4-methylcyclohexan-1-amine (CID 157323652) is heptan-1-amine;4-methylcyclohexan-1-amine.
What is the SMILES notation for heptan-1-amine;4-methylcyclohexan-1-amine?
The canonical SMILES for heptan-1-amine;4-methylcyclohexan-1-amine is CC1CCC(N)CC1.CCCCCCCN.
What is the InChIKey of heptan-1-amine;4-methylcyclohexan-1-amine?
The InChIKey is BELQSCHPUNSCOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C7H17N/c1-6-2-4-7(8)5-3-6;1-2-3-4-5-6-7-8/h6-7H,2-5,8H2,1H3;2-8H2,1H3.
What are the key properties of heptan-1-amine;4-methylcyclohexan-1-amine?
heptan-1-amine;4-methylcyclohexan-1-amine has a molecular weight of 228.42 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-1-amine;4-methylcyclohexan-1-amine is sourced from PubChem (CID 157323652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).