C19H32O5 — CID 157324275
methane;(3E,7E,9S,10S,11R,12Z)-9-methoxy-10-(methoxymethoxy)-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one (PubChem CID 157324275) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is methane;(3E,7E,9S,10S,11R,12Z)-9-methoxy-10-(methoxymethoxy)-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one.
| Compound Name | methane;(3E,7E,9S,10S,11R,12Z)-9-methoxy-10-(methoxymethoxy)-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
|---|---|
| PubChem CID | 157324275 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | methane;(3E,7E,9S,10S,11R,12Z)-9-methoxy-10-(methoxymethoxy)-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
| SMILES | C.COCO[C@H]1[C@H](C)/C=C(/C)COC(=O)/C=C/CC/C=C/[C@@H]1OC |
| InChI | InChI=1S/C18H28O5.CH4/c1-14-11-15(2)18(23-13-20-3)16(21-4)9-7-5-6-8-10-17(19)22-12-14;/h7-11,15-16,18H,5-6,12-13H2,1-4H3;1H4/b9-7+,10-8+,14-11-;/t15-,16+,18+;/m1./s1 |
| InChIKey | BENIYATUASVFQK-AUTGSVCDSA-N |
| XLogP | 3.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|