C9H14N2O2 — CID 157326065
2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;1H-imidazole (PubChem CID 157326065) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;1H-imidazole.
| Compound Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;1H-imidazole |
|---|---|
| PubChem CID | 157326065 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;1H-imidazole |
| SMILES | C1CC2OCCC2O1.c1c[nH]cn1 |
| InChI | InChI=1S/C6H10O2.C3H4N2/c1-3-7-6-2-4-8-5(1)6;1-2-5-3-4-1/h5-6H,1-4H2;1-3H,(H,4,5) |
| InChIKey | BESQSEJPBMEQPF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |