C15H26KN2O5-5 — CID 157326738
potassium;ethyl 3-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-3-oxopropanoate;hexakis(tritide) (PubChem CID 157326738) has the molecular formula C15H26KN2O5-5 and a molecular weight of 365.53 g/mol. Its IUPAC name is potassium;ethyl 3-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-3-oxopropanoate;hexakis(tritide).
| Compound Name | potassium;ethyl 3-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-3-oxopropanoate;hexakis(tritide) |
|---|---|
| PubChem CID | 157326738 |
| Molecular Formula | C15H26KN2O5-5 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | potassium;ethyl 3-[2-(2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazol-5-yl]-3-oxopropanoate;hexakis(tritide) |
| SMILES | CCOC(=O)CC(=O)C1CCc2nn(CC(=O)OC)cc2C1.[3H-].[3H-].[3H-].[3H-].[3H-].[3H-].[K+] |
| InChI | InChI=1S/C15H20N2O5.K.6H/c1-3-22-14(19)7-13(18)10-4-5-12-11(6-10)8-17(16-12)9-15(20)21-2;;;;;;;/h8,10H,3-7,9H2,1-2H3;;;;;;;/q;+1;6*-1/i;;6*1+2 |
| InChIKey | HKHDZAPZOMHGJP-UITAOIBBSA-N |
| XLogP | -1.64 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|