About 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine
2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine (PubChem CID 157326859) has the molecular formula C20H26N2S2
and a molecular weight of 358.58 g/mol. Its IUPAC name is 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine.
Molecular Properties
| Compound Name | 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine |
| PubChem CID | 157326859 |
| Molecular Formula | C20H26N2S2 |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine |
| SMILES | [H]/N=C(/Cc1ccc2c(c1)SCCN2CCCCCC)c1cccs1 |
| InChI | InChI=1S/C20H26N2S2/c1-2-3-4-5-10-22-11-13-24-20-15-16(8-9-18(20)22)14-17(21)19-7-6-12-23-19/h6-9,12,15,21H,2-5,10-11,13-14H2,1H3/b21-17- |
| InChIKey | OIXBODQLMYOFKT-FXBPSFAMSA-N |
| XLogP | 5.85 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine?
The IUPAC name of 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine (CID 157326859) is 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine.
What is the SMILES notation for 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine?
The canonical SMILES for 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine is [H]/N=C(/Cc1ccc2c(c1)SCCN2CCCCCC)c1cccs1.
What is the InChIKey of 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine?
The InChIKey is OIXBODQLMYOFKT-FXBPSFAMSA-N. The full InChI is InChI=1S/C20H26N2S2/c1-2-3-4-5-10-22-11-13-24-20-15-16(8-9-18(20)22)14-17(21)19-7-6-12-23-19/h6-9,12,15,21H,2-5,10-11,13-14H2,1H3/b21-17-.
What are the key properties of 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine?
2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine has a molecular weight of 358.58 g/mol, XLogP of 5.85, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hexyl-2,3-dihydro-1,4-benzothiazin-7-yl)-1-thiophen-2-ylethanimine is sourced from PubChem (CID 157326859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).