About dichloro(dimethyl)silane;dichloro(methyl)silane
dichloro(dimethyl)silane;dichloro(methyl)silane (PubChem CID 157326893) has the molecular formula C3H10Cl4Si2
and a molecular weight of 244.10 g/mol. Its IUPAC name is dichloro(dimethyl)silane;dichloro(methyl)silane.
Molecular Properties
| Compound Name | dichloro(dimethyl)silane;dichloro(methyl)silane |
| PubChem CID | 157326893 |
| Molecular Formula | C3H10Cl4Si2 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 241.91 |
| IUPAC Name | dichloro(dimethyl)silane;dichloro(methyl)silane |
| SMILES | C[SiH](Cl)Cl.C[Si](C)(Cl)Cl |
| InChI | InChI=1S/C2H6Cl2Si.CH4Cl2Si/c1-5(2,3)4;1-4(2)3/h1-2H3;4H,1H3 |
| InChIKey | BEVHYAMNRYKRBI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethyl)silane;dichloro(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethyl)silane;dichloro(methyl)silane?
The IUPAC name of dichloro(dimethyl)silane;dichloro(methyl)silane (CID 157326893) is dichloro(dimethyl)silane;dichloro(methyl)silane.
What is the SMILES notation for dichloro(dimethyl)silane;dichloro(methyl)silane?
The canonical SMILES for dichloro(dimethyl)silane;dichloro(methyl)silane is C[SiH](Cl)Cl.C[Si](C)(Cl)Cl.
What is the InChIKey of dichloro(dimethyl)silane;dichloro(methyl)silane?
The InChIKey is BEVHYAMNRYKRBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6Cl2Si.CH4Cl2Si/c1-5(2,3)4;1-4(2)3/h1-2H3;4H,1H3.
What are the key properties of dichloro(dimethyl)silane;dichloro(methyl)silane?
dichloro(dimethyl)silane;dichloro(methyl)silane has a molecular weight of 244.10 g/mol, XLogP of 3.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethyl)silane;dichloro(methyl)silane is sourced from PubChem (CID 157326893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).