C12H28N2 — CID 157328296
N,N-dimethylethanamine;1-ethyl-4-methylpiperidine (PubChem CID 157328296) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is N,N-dimethylethanamine;1-ethyl-4-methylpiperidine.
| Compound Name | N,N-dimethylethanamine;1-ethyl-4-methylpiperidine |
|---|---|
| PubChem CID | 157328296 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N,N-dimethylethanamine;1-ethyl-4-methylpiperidine |
| SMILES | CCN(C)C.CCN1CCC(C)CC1 |
| InChI | InChI=1S/C8H17N.C4H11N/c1-3-9-6-4-8(2)5-7-9;1-4-5(2)3/h8H,3-7H2,1-2H3;4H2,1-3H3 |
| InChIKey | BEZGMLWFHQZPKP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |