C19H17FN4O3S — CID 157328398
4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]-2-fluorobenzenesulfonamide (PubChem CID 157328398) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 157328398 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]-2-fluorobenzenesulfonamide |
| SMILES | Cc1ccc(-c2cnc(N)c(C(=O)Cc3ccc(S(N)(=O)=O)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C19H17FN4O3S/c1-11-2-5-13(6-3-11)15-10-23-19(21)18(24-15)16(25)9-12-4-7-17(14(20)8-12)28(22,26)27/h2-8,10H,9H2,1H3,(H2,21,23)(H2,22,26,27) |
| InChIKey | VRCNWRNULIAEAR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |