About cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol
cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol (PubChem CID 157330429) has the molecular formula C24H48O6
and a molecular weight of 432.64 g/mol. Its IUPAC name is cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol.
Molecular Properties
| Compound Name | cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol |
| PubChem CID | 157330429 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol |
| SMILES | C1CCCCC1.CCO.CCOCC(O)COCC1CCC(COCC2CO2)CC1 |
| InChI | InChI=1S/C16H30O5.C6H12.C2H6O/c1-2-18-9-15(17)10-19-7-13-3-5-14(6-4-13)8-20-11-16-12-21-16;1-2-4-6-5-3-1;1-2-3/h13-17H,2-12H2,1H3;1-6H2;3H,2H2,1H3 |
| InChIKey | BFFJTYXYXCTZJF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol?
The IUPAC name of cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol (CID 157330429) is cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol.
What is the SMILES notation for cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol?
The canonical SMILES for cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol is C1CCCCC1.CCO.CCOCC(O)COCC1CCC(COCC2CO2)CC1.
What is the InChIKey of cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol?
The InChIKey is BFFJTYXYXCTZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O5.C6H12.C2H6O/c1-2-18-9-15(17)10-19-7-13-3-5-14(6-4-13)8-20-11-16-12-21-16;1-2-4-6-5-3-1;1-2-3/h13-17H,2-12H2,1H3;1-6H2;3H,2H2,1H3.
What are the key properties of cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol?
cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol has a molecular weight of 432.64 g/mol, XLogP of 3.96, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;ethanol;1-ethoxy-3-[[4-(oxiran-2-ylmethoxymethyl)cyclohexyl]methoxy]propan-2-ol is sourced from PubChem (CID 157330429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).