About 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol
2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol (PubChem CID 15733086) has the molecular formula C15H12N6O2
and a molecular weight of 308.30 g/mol. Its IUPAC name is 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol.
Molecular Properties
| Compound Name | 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol |
| PubChem CID | 15733086 |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol |
| SMILES | Oc1cc(-n2cccn2)c(O)c(-n2cccn2)c1-n1cccn1 |
| InChI | InChI=1S/C15H12N6O2/c22-12-10-11(19-7-1-4-16-19)15(23)14(21-9-3-6-18-21)13(12)20-8-2-5-17-20/h1-10,22-23H |
| InChIKey | OHUJWPNDGOJZEW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol?
The IUPAC name of 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol (CID 15733086) is 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol.
What is the SMILES notation for 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol?
The canonical SMILES for 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol is Oc1cc(-n2cccn2)c(O)c(-n2cccn2)c1-n1cccn1.
What is the InChIKey of 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol?
The InChIKey is OHUJWPNDGOJZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N6O2/c22-12-10-11(19-7-1-4-16-19)15(23)14(21-9-3-6-18-21)13(12)20-8-2-5-17-20/h1-10,22-23H.
What are the key properties of 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol?
2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol has a molecular weight of 308.30 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-tri(pyrazol-1-yl)benzene-1,4-diol is sourced from PubChem (CID 15733086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).