C30H33F6N2O5P — CID 157330896
4-[[(2S)-2-aminobutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid (PubChem CID 157330896) has the molecular formula C30H33F6N2O5P and a molecular weight of 646.57 g/mol. Its IUPAC name is 4-[[(2S)-2-aminobutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(2S)-2-aminobutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157330896 |
| Molecular Formula | C30H33F6N2O5P |
| Molecular Weight | 646.57 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 4-[[(2S)-2-aminobutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@H](N)C(=O)NCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C(O)C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H31N2OP.2C2HF3O2/c1-2-25(27)26(29)28-20-12-13-21-30(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24;2*3-2(4,5)1(6)7/h3-11,14-19,25H,2,12-13,20-21,27H2,1H3;2*(H,6,7)/t25-;;/m0../s1 |
| InChIKey | BFGVPCMOJMIDES-WLOLSGMKSA-N |
| XLogP | 3.55 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|