About 3-methylpiperidin-2-one;5-methylpiperidin-2-one
3-methylpiperidin-2-one;5-methylpiperidin-2-one (PubChem CID 157332595) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-methylpiperidin-2-one;5-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 3-methylpiperidin-2-one;5-methylpiperidin-2-one |
| PubChem CID | 157332595 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-methylpiperidin-2-one;5-methylpiperidin-2-one |
| SMILES | CC1CCC(=O)NC1.CC1CCCNC1=O |
| InChI | InChI=1S/2C6H11NO/c1-5-2-3-6(8)7-4-5;1-5-3-2-4-7-6(5)8/h2*5H,2-4H2,1H3,(H,7,8) |
| InChIKey | BFLRUCOHMYJUGN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylpiperidin-2-one;5-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpiperidin-2-one;5-methylpiperidin-2-one?
The IUPAC name of 3-methylpiperidin-2-one;5-methylpiperidin-2-one (CID 157332595) is 3-methylpiperidin-2-one;5-methylpiperidin-2-one.
What is the SMILES notation for 3-methylpiperidin-2-one;5-methylpiperidin-2-one?
The canonical SMILES for 3-methylpiperidin-2-one;5-methylpiperidin-2-one is CC1CCC(=O)NC1.CC1CCCNC1=O.
What is the InChIKey of 3-methylpiperidin-2-one;5-methylpiperidin-2-one?
The InChIKey is BFLRUCOHMYJUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11NO/c1-5-2-3-6(8)7-4-5;1-5-3-2-4-7-6(5)8/h2*5H,2-4H2,1H3,(H,7,8).
What are the key properties of 3-methylpiperidin-2-one;5-methylpiperidin-2-one?
3-methylpiperidin-2-one;5-methylpiperidin-2-one has a molecular weight of 226.32 g/mol, XLogP of 1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpiperidin-2-one;5-methylpiperidin-2-one is sourced from PubChem (CID 157332595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).