C21H23NOS — CID 157334025
(5R,7R,9S)-9-ethyl-5,7-dimethyl-9-phenyl-4,5,6,7-tetrahydrobenzo[f][1,3]benzothiazol-8-one (PubChem CID 157334025) has the molecular formula C21H23NOS and a molecular weight of 337.49 g/mol. Its IUPAC name is (5R,7R,9S)-9-ethyl-5,7-dimethyl-9-phenyl-4,5,6,7-tetrahydrobenzo[f][1,3]benzothiazol-8-one.
| Compound Name | (5R,7R,9S)-9-ethyl-5,7-dimethyl-9-phenyl-4,5,6,7-tetrahydrobenzo[f][1,3]benzothiazol-8-one |
|---|---|
| PubChem CID | 157334025 |
| Molecular Formula | C21H23NOS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (5R,7R,9S)-9-ethyl-5,7-dimethyl-9-phenyl-4,5,6,7-tetrahydrobenzo[f][1,3]benzothiazol-8-one |
| SMILES | CC[C@]1(c2ccccc2)C2=C(Cc3ncsc31)[C@H](C)C[C@@H](C)C2=O |
| InChI | InChI=1S/C21H23NOS/c1-4-21(15-8-6-5-7-9-15)18-16(11-17-20(21)24-12-22-17)13(2)10-14(3)19(18)23/h5-9,12-14H,4,10-11H2,1-3H3/t13-,14-,21+/m1/s1 |
| InChIKey | CJFUZTASXQHSCC-LKBUQDJMSA-N |
| XLogP | 4.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |