C34H44N2O6 — CID 157334172
(2R,3R)-3-(benzylamino)-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol;tert-butyl N-[(2R,3R)-3-hydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 157334172) has the molecular formula C34H44N2O6 and a molecular weight of 576.73 g/mol. Its IUPAC name is (2R,3R)-3-(benzylamino)-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol;tert-butyl N-[(2R,3R)-3-hydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | (2R,3R)-3-(benzylamino)-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol;tert-butyl N-[(2R,3R)-3-hydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 157334172 |
| Molecular Formula | C34H44N2O6 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | (2R,3R)-3-(benzylamino)-8-methoxy-1,2,3,4-tetrahydronaphthalen-2-ol;tert-butyl N-[(2R,3R)-3-hydroxy-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | COc1cccc2c1C[C@@H](O)[C@H](NC(=O)OC(C)(C)C)C2.COc1cccc2c1C[C@@H](O)[C@H](NCc1ccccc1)C2 |
| InChI | InChI=1S/C18H21NO2.C16H23NO4/c1-21-18-9-5-8-14-10-16(17(20)11-15(14)18)19-12-13-6-3-2-4-7-13;1-16(2,3)21-15(19)17-12-8-10-6-5-7-14(20-4)11(10)9-13(12)18/h2-9,16-17,19-20H,10-12H2,1H3;5-7,12-13,18H,8-9H2,1-4H3,(H,17,19)/t16-,17-;12-,13-/m11/s1 |
| InChIKey | BFQFHLKRCCJUCB-VEGQHCLKSA-N |
| XLogP | 4.36 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |