About 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate
1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate (PubChem CID 157334480) has the molecular formula C21H21Br2F4IO4
and a molecular weight of 700.10 g/mol. Its IUPAC name is 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate |
| PubChem CID | 157334480 |
| Molecular Formula | C21H21Br2F4IO4 |
| Molecular Weight | 700.10 g/mol |
| Exact Mass | 697.88 |
| IUPAC Name | 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate |
| SMILES | Brc1ccc(I)cc1.CCOC(=O)C(C)(F)F.CCOC(=O)C(F)(F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H9BrF2O2.C6H4BrI.C5H8F2O2/c1-2-15-9(14)10(12,13)7-3-5-8(11)6-4-7;7-5-1-3-6(8)4-2-5;1-3-9-4(8)5(2,6)7/h3-6H,2H2,1H3;1-4H;3H2,1-2H3 |
| InChIKey | BFRFZGKKNSWLKZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 700.10 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate?
The IUPAC name of 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate (CID 157334480) is 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate.
What is the SMILES notation for 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate?
The canonical SMILES for 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate is Brc1ccc(I)cc1.CCOC(=O)C(C)(F)F.CCOC(=O)C(F)(F)c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate?
The InChIKey is BFRFZGKKNSWLKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O2.C6H4BrI.C5H8F2O2/c1-2-15-9(14)10(12,13)7-3-5-8(11)6-4-7;7-5-1-3-6(8)4-2-5;1-3-9-4(8)5(2,6)7/h3-6H,2H2,1H3;1-4H;3H2,1-2H3.
What are the key properties of 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate?
1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate has a molecular weight of 700.10 g/mol, XLogP of 7.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-iodobenzene;ethyl 2-(4-bromophenyl)-2,2-difluoroacetate;ethyl 2,2-difluoropropanoate is sourced from PubChem (CID 157334480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).