C21H24N2OS — CID 157334712
4-[3-isocyano-5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)thiophen-2-yl]morpholine (PubChem CID 157334712) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 4-[3-isocyano-5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)thiophen-2-yl]morpholine.
| Compound Name | 4-[3-isocyano-5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)thiophen-2-yl]morpholine |
|---|---|
| PubChem CID | 157334712 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4-[3-isocyano-5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)thiophen-2-yl]morpholine |
| SMILES | [C-]#[N+]c1c(N2CCOCC2)sc(C)c1Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H24N2OS/c1-15-19(14-16-7-8-17-5-3-4-6-18(17)13-16)20(22-2)21(25-15)23-9-11-24-12-10-23/h7-8,13H,3-6,9-12,14H2,1H3 |
| InChIKey | SANIXXXWGDVDME-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|