C11H21F3N2O — CID 157334875
(3S,5R)-3,5-dimethyl-1-propan-2-ylpiperazine;2,2,2-trifluoroacetaldehyde (PubChem CID 157334875) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-1-propan-2-ylpiperazine;2,2,2-trifluoroacetaldehyde.
| Compound Name | (3S,5R)-3,5-dimethyl-1-propan-2-ylpiperazine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 157334875 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-1-propan-2-ylpiperazine;2,2,2-trifluoroacetaldehyde |
| SMILES | CC(C)N1C[C@@H](C)N[C@@H](C)C1.O=CC(F)(F)F |
| InChI | InChI=1S/C9H20N2.C2HF3O/c1-7(2)11-5-8(3)10-9(4)6-11;3-2(4,5)1-6/h7-10H,5-6H2,1-4H3;1H/t8-,9+; |
| InChIKey | BFSMCEYCKOSDJR-UFIFRZAQSA-N |
| XLogP | 1.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|