About benzene;hydron;hexafluorophosphate
benzene;hydron;hexafluorophosphate (PubChem CID 157335526) has the molecular formula C6H7F6P
and a molecular weight of 224.08 g/mol. Its IUPAC name is benzene;hydron;hexafluorophosphate.
Molecular Properties
| Compound Name | benzene;hydron;hexafluorophosphate |
| PubChem CID | 157335526 |
| Molecular Formula | C6H7F6P |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | benzene;hydron;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[H+].c1ccccc1 |
| InChI | InChI=1S/C6H6.F6P/c1-2-4-6-5-3-1;1-7(2,3,4,5)6/h1-6H;/q;-1/p+1 |
| InChIKey | BFUHAUFOXZWVIO-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;hydron;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;hydron;hexafluorophosphate?
The IUPAC name of benzene;hydron;hexafluorophosphate (CID 157335526) is benzene;hydron;hexafluorophosphate.
What is the SMILES notation for benzene;hydron;hexafluorophosphate?
The canonical SMILES for benzene;hydron;hexafluorophosphate is F[P-](F)(F)(F)(F)F.[H+].c1ccccc1.
What is the InChIKey of benzene;hydron;hexafluorophosphate?
The InChIKey is BFUHAUFOXZWVIO-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6.F6P/c1-2-4-6-5-3-1;1-7(2,3,4,5)6/h1-6H;/q;-1/p+1.
What are the key properties of benzene;hydron;hexafluorophosphate?
benzene;hydron;hexafluorophosphate has a molecular weight of 224.08 g/mol, XLogP of 5.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;hydron;hexafluorophosphate is sourced from PubChem (CID 157335526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).