About 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene
4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene (PubChem CID 157335604) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene.
Molecular Properties
| Compound Name | 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene |
| PubChem CID | 157335604 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene |
| SMILES | CCCc1cccc(-c2ccccc2)c1.O=C(O)C1=NOCC1 |
| InChI | InChI=1S/C15H16.C4H5NO3/c1-2-7-13-8-6-11-15(12-13)14-9-4-3-5-10-14;6-4(7)3-1-2-8-5-3/h3-6,8-12H,2,7H2,1H3;1-2H2,(H,6,7) |
| InChIKey | BFUNGDKASUFMRR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene?
The IUPAC name of 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene (CID 157335604) is 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene.
What is the SMILES notation for 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene?
The canonical SMILES for 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene is CCCc1cccc(-c2ccccc2)c1.O=C(O)C1=NOCC1.
What is the InChIKey of 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene?
The InChIKey is BFUNGDKASUFMRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C4H5NO3/c1-2-7-13-8-6-11-15(12-13)14-9-4-3-5-10-14;6-4(7)3-1-2-8-5-3/h3-6,8-12H,2,7H2,1H3;1-2H2,(H,6,7).
What are the key properties of 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene?
4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene has a molecular weight of 311.38 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,2-oxazole-3-carboxylic acid;1-phenyl-3-propylbenzene is sourced from PubChem (CID 157335604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).