C45H90N6 — CID 157335949
2,8-ditert-butyl-2,8-diazaspiro[4.5]decane;2,7-ditert-butyl-2,7-diazaspiro[4.4]nonane;2,7-ditert-butyl-2,7-diazaspiro[3.4]octane (PubChem CID 157335949) has the molecular formula C45H90N6 and a molecular weight of 715.26 g/mol. Its IUPAC name is 2,8-ditert-butyl-2,8-diazaspiro[4.5]decane;2,7-ditert-butyl-2,7-diazaspiro[4.4]nonane;2,7-ditert-butyl-2,7-diazaspiro[3.4]octane.
| Compound Name | 2,8-ditert-butyl-2,8-diazaspiro[4.5]decane;2,7-ditert-butyl-2,7-diazaspiro[4.4]nonane;2,7-ditert-butyl-2,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 157335949 |
| Molecular Formula | C45H90N6 |
| Molecular Weight | 715.26 g/mol |
| Exact Mass | 714.72 |
| IUPAC Name | 2,8-ditert-butyl-2,8-diazaspiro[4.5]decane;2,7-ditert-butyl-2,7-diazaspiro[4.4]nonane;2,7-ditert-butyl-2,7-diazaspiro[3.4]octane |
| SMILES | CC(C)(C)N1CCC2(C1)CN(C(C)(C)C)C2.CC(C)(C)N1CCC2(CC1)CCN(C(C)(C)C)C2.CC(C)(C)N1CCC2(CCN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C16H32N2.C15H30N2.C14H28N2/c1-14(2,3)17-10-7-16(8-11-17)9-12-18(13-16)15(4,5)6;1-13(2,3)16-9-7-15(11-16)8-10-17(12-15)14(4,5)6;1-12(2,3)15-8-7-14(9-15)10-16(11-14)13(4,5)6/h7-13H2,1-6H3;7-12H2,1-6H3;7-11H2,1-6H3 |
| InChIKey | BFVLYMMRFSEIKL-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.26 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |