About benzaldehyde;2-phenyl-1,3-oxazole
benzaldehyde;2-phenyl-1,3-oxazole (PubChem CID 157335957) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is benzaldehyde;2-phenyl-1,3-oxazole.
Molecular Properties
| Compound Name | benzaldehyde;2-phenyl-1,3-oxazole |
| PubChem CID | 157335957 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | benzaldehyde;2-phenyl-1,3-oxazole |
| SMILES | O=Cc1ccccc1.c1ccc(-c2ncco2)cc1 |
| InChI | InChI=1S/C9H7NO.C7H6O/c1-2-4-8(5-3-1)9-10-6-7-11-9;8-6-7-4-2-1-3-5-7/h1-7H;1-6H |
| InChIKey | BFVMFHVKPFBFJA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;2-phenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;2-phenyl-1,3-oxazole?
The IUPAC name of benzaldehyde;2-phenyl-1,3-oxazole (CID 157335957) is benzaldehyde;2-phenyl-1,3-oxazole.
What is the SMILES notation for benzaldehyde;2-phenyl-1,3-oxazole?
The canonical SMILES for benzaldehyde;2-phenyl-1,3-oxazole is O=Cc1ccccc1.c1ccc(-c2ncco2)cc1.
What is the InChIKey of benzaldehyde;2-phenyl-1,3-oxazole?
The InChIKey is BFVMFHVKPFBFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C7H6O/c1-2-4-8(5-3-1)9-10-6-7-11-9;8-6-7-4-2-1-3-5-7/h1-7H;1-6H.
What are the key properties of benzaldehyde;2-phenyl-1,3-oxazole?
benzaldehyde;2-phenyl-1,3-oxazole has a molecular weight of 251.29 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;2-phenyl-1,3-oxazole is sourced from PubChem (CID 157335957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).