C17H14FN5O2 — CID 157336252
2-(2-fluoro-4-pyridinyl)-6-hydroxy-3-isocyano-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide (PubChem CID 157336252) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-(2-fluoro-4-pyridinyl)-6-hydroxy-3-isocyano-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide.
| Compound Name | 2-(2-fluoro-4-pyridinyl)-6-hydroxy-3-isocyano-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 157336252 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-(2-fluoro-4-pyridinyl)-6-hydroxy-3-isocyano-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide |
| SMILES | [C-]#[N+]c1ccc(O)c(C(=O)NC2=NCCCN2)c1-c1ccnc(F)c1 |
| InChI | InChI=1S/C17H14FN5O2/c1-19-11-3-4-12(24)15(14(11)10-5-8-20-13(18)9-10)16(25)23-17-21-6-2-7-22-17/h3-5,8-9,24H,2,6-7H2,(H2,21,22,23,25) |
| InChIKey | BFWHNZDRGCDVEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|