About phenyldiazene;pyrimidine
phenyldiazene;pyrimidine (PubChem CID 157336996) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is phenyldiazene;pyrimidine.
Molecular Properties
| Compound Name | phenyldiazene;pyrimidine |
| PubChem CID | 157336996 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | phenyldiazene;pyrimidine |
| SMILES | [H]/N=N/c1ccccc1.c1cncnc1 |
| InChI | InChI=1S/C6H6N2.C4H4N2/c7-8-6-4-2-1-3-5-6;1-2-5-4-6-3-1/h1-5,7H;1-4H/b8-7+; |
| InChIKey | BFYHHKOWONPWMY-USRGLUTNSA-N |
| XLogP | 2.83 |
| TPSA | 61.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze phenyldiazene;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyldiazene;pyrimidine?
The IUPAC name of phenyldiazene;pyrimidine (CID 157336996) is phenyldiazene;pyrimidine.
What is the SMILES notation for phenyldiazene;pyrimidine?
The canonical SMILES for phenyldiazene;pyrimidine is [H]/N=N/c1ccccc1.c1cncnc1.
What is the InChIKey of phenyldiazene;pyrimidine?
The InChIKey is BFYHHKOWONPWMY-USRGLUTNSA-N. The full InChI is InChI=1S/C6H6N2.C4H4N2/c7-8-6-4-2-1-3-5-6;1-2-5-4-6-3-1/h1-5,7H;1-4H/b8-7+;.
What are the key properties of phenyldiazene;pyrimidine?
phenyldiazene;pyrimidine has a molecular weight of 186.22 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyldiazene;pyrimidine is sourced from PubChem (CID 157336996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).